C10H17NO3 — CID 112627490
prop-2-enyl 3-(1-hydroxyethyl)pyrrolidine-1-carboxylate (PubChem CID 112627490) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is prop-2-enyl 3-(1-hydroxyethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 3-(1-hydroxyethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 112627490 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | prop-2-enyl 3-(1-hydroxyethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(C(C)O)C1 |
| InChI | InChI=1S/C10H17NO3/c1-3-6-14-10(13)11-5-4-9(7-11)8(2)12/h3,8-9,12H,1,4-7H2,2H3 |
| InChIKey | SQOAREDEPPJKMK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|