C51H70N2O4 — CID 11262815
bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] nonanedioate (PubChem CID 11262815) has the molecular formula C51H70N2O4 and a molecular weight of 775.13 g/mol. Its IUPAC name is bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] nonanedioate.
| Compound Name | bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] nonanedioate |
|---|---|
| PubChem CID | 11262815 |
| Molecular Formula | C51H70N2O4 |
| Molecular Weight | 775.13 g/mol |
| Exact Mass | 774.53 |
| IUPAC Name | bis[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] nonanedioate |
| SMILES | O=C(CCCCCCCC(=O)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C51H70N2O4/c54-48(56-40-22-20-38-30-46-42-16-6-8-24-50(42,44(38)32-40)26-28-52(46)34-36-12-10-13-36)18-4-2-1-3-5-19-49(55)57-41-23-21-39-31-47-43-17-7-9-25-51(43,45(39)33-41)27-29-53(47)35-37-14-11-15-37/h20-23,32-33,36-37,42-43,46-47H,1-19,24-31,34-35H2/t42-,43-,46+,47+,50+,51+/m0/s1 |
| InChIKey | BLLZZELIHPPMIK-UXSWXOBSSA-N |
| XLogP | 10.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.13 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|