C42H48O16 — CID 11262903
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoate (PubChem CID 11262903) has the molecular formula C42H48O16 and a molecular weight of 808.83 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoate.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 11262903 |
| Molecular Formula | C42H48O16 |
| Molecular Weight | 808.83 g/mol |
| Exact Mass | 808.29 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,5-bis[(5-acetyl-4,7-dimethoxy-1-benzofuran-6-yl)oxymethyl]benzoate |
| SMILES | COCCOCCOCCOCCOC(=O)c1cc(COc2c(C(C)=O)c(OC)c3ccoc3c2OC)ccc1COc1c(C(C)=O)c(OC)c2ccoc2c1OC |
| InChI | InChI=1S/C42H48O16/c1-25(43)32-34(47-4)29-10-12-54-36(29)40(49-6)38(32)57-23-27-8-9-28(31(22-27)42(45)56-21-20-53-19-18-52-17-16-51-15-14-46-3)24-58-39-33(26(2)44)35(48-5)30-11-13-55-37(30)41(39)50-7/h8-13,22H,14-21,23-24H2,1-7H3 |
| InChIKey | APTKGVODCSQHSR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 179.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.83 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|