C29H45N5O3 — CID 11262993
(2S,4S)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-butanoyl-4-naphthalen-2-yloxypyrrolidine-2-carboxamide (PubChem CID 11262993) has the molecular formula C29H45N5O3 and a molecular weight of 511.71 g/mol. Its IUPAC name is (2S,4S)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-butanoyl-4-naphthalen-2-yloxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-butanoyl-4-naphthalen-2-yloxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11262993 |
| Molecular Formula | C29H45N5O3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | (2S,4S)-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-1-butanoyl-4-naphthalen-2-yloxypyrrolidine-2-carboxamide |
| SMILES | CCCC(=O)N1C[C@@H](Oc2ccc3ccccc3c2)C[C@H]1C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C29H45N5O3/c1-2-9-28(35)34-22-26(37-25-13-12-23-10-3-4-11-24(23)20-25)21-27(34)29(36)33-19-8-18-32-16-6-5-15-31-17-7-14-30/h3-4,10-13,20,26-27,31-32H,2,5-9,14-19,21-22,30H2,1H3,(H,33,36)/t26-,27-/m0/s1 |
| InChIKey | AVVXVEHFZWVQTJ-SVBPBHIXSA-N |
| XLogP | 2.80 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|