C10H18N2O — CID 112630526
[3-(1-aminoethyl)pyrrolidin-1-yl]-cyclopropylmethanone (PubChem CID 112630526) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is [3-(1-aminoethyl)pyrrolidin-1-yl]-cyclopropylmethanone.
| Compound Name | [3-(1-aminoethyl)pyrrolidin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 112630526 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | [3-(1-aminoethyl)pyrrolidin-1-yl]-cyclopropylmethanone |
| SMILES | CC(N)C1CCN(C(=O)C2CC2)C1 |
| InChI | InChI=1S/C10H18N2O/c1-7(11)9-4-5-12(6-9)10(13)8-2-3-8/h7-9H,2-6,11H2,1H3 |
| InChIKey | PFXXZGOLGSRZBS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |