C14H15BrFNS — CID 112632402
N-[(5-bromothiophen-2-yl)methyl]-1-(2-fluorophenyl)propan-1-amine (PubChem CID 112632402) has the molecular formula C14H15BrFNS and a molecular weight of 328.25 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-1-(2-fluorophenyl)propan-1-amine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-1-(2-fluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 112632402 |
| Molecular Formula | C14H15BrFNS |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-1-(2-fluorophenyl)propan-1-amine |
| SMILES | CCC(NCc1ccc(Br)s1)c1ccccc1F |
| InChI | InChI=1S/C14H15BrFNS/c1-2-13(11-5-3-4-6-12(11)16)17-9-10-7-8-14(15)18-10/h3-8,13,17H,2,9H2,1H3 |
| InChIKey | UNGWADNANZKOFV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |