C14H21NO2 — CID 112633908
3-[2-(1-hydroxyethyl)anilino]-2,2-dimethylcyclobutan-1-ol (PubChem CID 112633908) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-[2-(1-hydroxyethyl)anilino]-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-[2-(1-hydroxyethyl)anilino]-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 112633908 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-[2-(1-hydroxyethyl)anilino]-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC(O)c1ccccc1NC1CC(O)C1(C)C |
| InChI | InChI=1S/C14H21NO2/c1-9(16)10-6-4-5-7-11(10)15-12-8-13(17)14(12,2)3/h4-7,9,12-13,15-17H,8H2,1-3H3 |
| InChIKey | DOODPGMJBLXJBR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |