C10H18F3NO2 — CID 112634046
2,2-dimethyl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclobutan-1-ol (PubChem CID 112634046) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 112634046 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2,2-dimethyl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-9(2)7(5-8(9)15)14-3-4-16-6-10(11,12)13/h7-8,14-15H,3-6H2,1-2H3 |
| InChIKey | JTQMBXFTDOYRJY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|