C12H12F5NO — CID 112634227
2,2-dimethyl-3-(2,3,4,5,6-pentafluoroanilino)cyclobutan-1-ol (PubChem CID 112634227) has the molecular formula C12H12F5NO and a molecular weight of 281.22 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,3,4,5,6-pentafluoroanilino)cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-(2,3,4,5,6-pentafluoroanilino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 112634227 |
| Molecular Formula | C12H12F5NO |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2,2-dimethyl-3-(2,3,4,5,6-pentafluoroanilino)cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO/c1-12(2)4(3-5(12)19)18-11-9(16)7(14)6(13)8(15)10(11)17/h4-5,18-19H,3H2,1-2H3 |
| InChIKey | XUIZRKJDFDFFSI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|