About 1-cyclohexyltetrazole
1-cyclohexyltetrazole (PubChem CID 11263601) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-cyclohexyltetrazole.
Molecular Properties
| Compound Name | 1-cyclohexyltetrazole |
| PubChem CID | 11263601 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 1-cyclohexyltetrazole |
| SMILES | c1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C7H12N4/c1-2-4-7(5-3-1)11-6-8-9-10-11/h6-7H,1-5H2 |
| InChIKey | VUTGCJAAPNDVLD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyltetrazole?
The IUPAC name of 1-cyclohexyltetrazole (CID 11263601) is 1-cyclohexyltetrazole.
What is the SMILES notation for 1-cyclohexyltetrazole?
The canonical SMILES for 1-cyclohexyltetrazole is c1nnnn1C1CCCCC1.
What is the InChIKey of 1-cyclohexyltetrazole?
The InChIKey is VUTGCJAAPNDVLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-2-4-7(5-3-1)11-6-8-9-10-11/h6-7H,1-5H2.
What are the key properties of 1-cyclohexyltetrazole?
1-cyclohexyltetrazole has a molecular weight of 152.20 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyltetrazole is sourced from PubChem (CID 11263601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).