C12H17N3O4 — CID 112636199
5-[[(4-ethoxypyrimidin-2-yl)amino]methyl]oxolane-2-carboxylic acid (PubChem CID 112636199) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-[[(4-ethoxypyrimidin-2-yl)amino]methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[[(4-ethoxypyrimidin-2-yl)amino]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 112636199 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 5-[[(4-ethoxypyrimidin-2-yl)amino]methyl]oxolane-2-carboxylic acid |
| SMILES | CCOc1ccnc(NCC2CCC(C(=O)O)O2)n1 |
| InChI | InChI=1S/C12H17N3O4/c1-2-18-10-5-6-13-12(15-10)14-7-8-3-4-9(19-8)11(16)17/h5-6,8-9H,2-4,7H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | LKLHZNZHNBEETM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |