About N-phenylcyclopentanimine
N-phenylcyclopentanimine (PubChem CID 11263654) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is N-phenylcyclopentanimine.
Molecular Properties
| Compound Name | N-phenylcyclopentanimine |
| PubChem CID | 11263654 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | N-phenylcyclopentanimine |
| SMILES | c1ccc(N=C2CCCC2)cc1 |
| InChI | InChI=1S/C11H13N/c1-2-6-10(7-3-1)12-11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | RTRXYGSDWNVHBI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenylcyclopentanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylcyclopentanimine?
The IUPAC name of N-phenylcyclopentanimine (CID 11263654) is N-phenylcyclopentanimine.
What is the SMILES notation for N-phenylcyclopentanimine?
The canonical SMILES for N-phenylcyclopentanimine is c1ccc(N=C2CCCC2)cc1.
What is the InChIKey of N-phenylcyclopentanimine?
The InChIKey is RTRXYGSDWNVHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-6-10(7-3-1)12-11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2.
What are the key properties of N-phenylcyclopentanimine?
N-phenylcyclopentanimine has a molecular weight of 159.23 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylcyclopentanimine is sourced from PubChem (CID 11263654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).