About magnesium;benzonitrile;chloride
magnesium;benzonitrile;chloride (PubChem CID 11263669) has the molecular formula C7H4ClMgN
and a molecular weight of 161.87 g/mol. Its IUPAC name is magnesium;benzonitrile;chloride.
Molecular Properties
| Compound Name | magnesium;benzonitrile;chloride |
| PubChem CID | 11263669 |
| Molecular Formula | C7H4ClMgN |
| Molecular Weight | 161.87 g/mol |
| Exact Mass | 160.99 |
| IUPAC Name | magnesium;benzonitrile;chloride |
| SMILES | N#Cc1c[c-]ccc1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C7H4N.ClH.Mg/c8-6-7-4-2-1-3-5-7;;/h1-2,4-5H;1H;/q-1;;+2/p-1 |
| InChIKey | AZFDJLLRMUDKHN-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.87 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;benzonitrile;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;benzonitrile;chloride?
The IUPAC name of magnesium;benzonitrile;chloride (CID 11263669) is magnesium;benzonitrile;chloride.
What is the SMILES notation for magnesium;benzonitrile;chloride?
The canonical SMILES for magnesium;benzonitrile;chloride is N#Cc1c[c-]ccc1.[Cl-].[Mg+2].
What is the InChIKey of magnesium;benzonitrile;chloride?
The InChIKey is AZFDJLLRMUDKHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4N.ClH.Mg/c8-6-7-4-2-1-3-5-7;;/h1-2,4-5H;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;benzonitrile;chloride?
magnesium;benzonitrile;chloride has a molecular weight of 161.87 g/mol, XLogP of -2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;benzonitrile;chloride is sourced from PubChem (CID 11263669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).