C11H19N3O3 — CID 112637344
4-ethoxy-N-[2-(2-methoxyethoxy)ethyl]pyrimidin-2-amine (PubChem CID 112637344) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(2-methoxyethoxy)ethyl]pyrimidin-2-amine.
| Compound Name | 4-ethoxy-N-[2-(2-methoxyethoxy)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112637344 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 4-ethoxy-N-[2-(2-methoxyethoxy)ethyl]pyrimidin-2-amine |
| SMILES | CCOc1ccnc(NCCOCCOC)n1 |
| InChI | InChI=1S/C11H19N3O3/c1-3-17-10-4-5-12-11(14-10)13-6-7-16-9-8-15-2/h4-5H,3,6-9H2,1-2H3,(H,12,13,14) |
| InChIKey | IRXSKASBMWWMBN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|