C10H18N4O — CID 112638424
1,1-dimethyl-2-(4-methyl-6-propoxypyrimidin-2-yl)hydrazine (PubChem CID 112638424) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,1-dimethyl-2-(4-methyl-6-propoxypyrimidin-2-yl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(4-methyl-6-propoxypyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 112638424 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1,1-dimethyl-2-(4-methyl-6-propoxypyrimidin-2-yl)hydrazine |
| SMILES | CCCOc1cc(C)nc(NN(C)C)n1 |
| InChI | InChI=1S/C10H18N4O/c1-5-6-15-9-7-8(2)11-10(12-9)13-14(3)4/h7H,5-6H2,1-4H3,(H,11,12,13) |
| InChIKey | PEARUAAOMWKVOV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|