C13H22N4O — CID 112638716
2-(2,2-dimethylpiperazin-1-yl)-4-propoxypyrimidine (PubChem CID 112638716) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-(2,2-dimethylpiperazin-1-yl)-4-propoxypyrimidine.
| Compound Name | 2-(2,2-dimethylpiperazin-1-yl)-4-propoxypyrimidine |
|---|---|
| PubChem CID | 112638716 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-(2,2-dimethylpiperazin-1-yl)-4-propoxypyrimidine |
| SMILES | CCCOc1ccnc(N2CCNCC2(C)C)n1 |
| InChI | InChI=1S/C13H22N4O/c1-4-9-18-11-5-6-15-12(16-11)17-8-7-14-10-13(17,2)3/h5-6,14H,4,7-10H2,1-3H3 |
| InChIKey | KQEQATKNAIIVEM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |