C10H16ClN3O — CID 112639274
N-(1-chloropropan-2-yl)-4-propan-2-yloxypyrimidin-2-amine (PubChem CID 112639274) has the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-4-propan-2-yloxypyrimidin-2-amine.
| Compound Name | N-(1-chloropropan-2-yl)-4-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 112639274 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(1-chloropropan-2-yl)-4-propan-2-yloxypyrimidin-2-amine |
| SMILES | CC(CCl)Nc1nccc(OC(C)C)n1 |
| InChI | InChI=1S/C10H16ClN3O/c1-7(2)15-9-4-5-12-10(14-9)13-8(3)6-11/h4-5,7-8H,6H2,1-3H3,(H,12,13,14) |
| InChIKey | VBQDCDROIYXUBY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|