C16H32N2O — CID 112639940
2-amino-N-(3,3,5,5-tetramethylcyclohexyl)hexanamide (PubChem CID 112639940) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-amino-N-(3,3,5,5-tetramethylcyclohexyl)hexanamide.
| Compound Name | 2-amino-N-(3,3,5,5-tetramethylcyclohexyl)hexanamide |
|---|---|
| PubChem CID | 112639940 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 2-amino-N-(3,3,5,5-tetramethylcyclohexyl)hexanamide |
| SMILES | CCCCC(N)C(=O)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H32N2O/c1-6-7-8-13(17)14(19)18-12-9-15(2,3)11-16(4,5)10-12/h12-13H,6-11,17H2,1-5H3,(H,18,19) |
| InChIKey | QRPCIOLXVFOINS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |