C8H6F4O — CID 11264020
1-(3,3,6,6-tetrafluorocyclohexa-1,4-dien-1-yl)ethanone (PubChem CID 11264020) has the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. Its IUPAC name is 1-(3,3,6,6-tetrafluorocyclohexa-1,4-dien-1-yl)ethanone.
| Compound Name | 1-(3,3,6,6-tetrafluorocyclohexa-1,4-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 11264020 |
| Molecular Formula | C8H6F4O |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-(3,3,6,6-tetrafluorocyclohexa-1,4-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC(F)(F)C=CC1(F)F |
| InChI | InChI=1S/C8H6F4O/c1-5(13)6-4-7(9,10)2-3-8(6,11)12/h2-4H,1H3 |
| InChIKey | MOBIEGFFXDOBNE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|