About 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one
1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one (PubChem CID 11264052) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one |
| PubChem CID | 11264052 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one |
| SMILES | COc1cc(OC)nc(CC(C)=O)n1 |
| InChI | InChI=1S/C9H12N2O3/c1-6(12)4-7-10-8(13-2)5-9(11-7)14-3/h5H,4H2,1-3H3 |
| InChIKey | MRPUESHNMJXBDD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one?
The IUPAC name of 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one (CID 11264052) is 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one.
What is the SMILES notation for 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one?
The canonical SMILES for 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one is COc1cc(OC)nc(CC(C)=O)n1.
What is the InChIKey of 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one?
The InChIKey is MRPUESHNMJXBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-6(12)4-7-10-8(13-2)5-9(11-7)14-3/h5H,4H2,1-3H3.
What are the key properties of 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one?
1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one has a molecular weight of 196.21 g/mol, XLogP of 0.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxypyrimidin-2-yl)propan-2-one is sourced from PubChem (CID 11264052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).