C11H8BrNO3S — CID 112640727
3-bromo-2-(1,3-thiazol-5-ylmethoxy)benzoic acid (PubChem CID 112640727) has the molecular formula C11H8BrNO3S and a molecular weight of 314.16 g/mol. Its IUPAC name is 3-bromo-2-(1,3-thiazol-5-ylmethoxy)benzoic acid.
| Compound Name | 3-bromo-2-(1,3-thiazol-5-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 112640727 |
| Molecular Formula | C11H8BrNO3S |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 3-bromo-2-(1,3-thiazol-5-ylmethoxy)benzoic acid |
| SMILES | O=C(O)c1cccc(Br)c1OCc1cncs1 |
| InChI | InChI=1S/C11H8BrNO3S/c12-9-3-1-2-8(11(14)15)10(9)16-5-7-4-13-6-17-7/h1-4,6H,5H2,(H,14,15) |
| InChIKey | PZPPXGHOFMUZCR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |