C11H12N2S2 — CID 112640823
5-methyl-2-(1,3-thiazol-5-ylmethylsulfanyl)aniline (PubChem CID 112640823) has the molecular formula C11H12N2S2 and a molecular weight of 236.37 g/mol. Its IUPAC name is 5-methyl-2-(1,3-thiazol-5-ylmethylsulfanyl)aniline.
| Compound Name | 5-methyl-2-(1,3-thiazol-5-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 112640823 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 5-methyl-2-(1,3-thiazol-5-ylmethylsulfanyl)aniline |
| SMILES | Cc1ccc(SCc2cncs2)c(N)c1 |
| InChI | InChI=1S/C11H12N2S2/c1-8-2-3-11(10(12)4-8)14-6-9-5-13-7-15-9/h2-5,7H,6,12H2,1H3 |
| InChIKey | RKELMRVZSAEVLW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|