C8H8O6 — CID 11264102
(1R,2S,6R,8R)-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,9-dione (PubChem CID 11264102) has the molecular formula C8H8O6 and a molecular weight of 200.15 g/mol. Its IUPAC name is (1R,2S,6R,8R)-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,9-dione.
| Compound Name | (1R,2S,6R,8R)-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,9-dione |
|---|---|
| PubChem CID | 11264102 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (1R,2S,6R,8R)-8-hydroxy-3,5,10-trioxatricyclo[6.2.1.02,6]undecane-4,9-dione |
| SMILES | O=C1O[C@@H]2[C@@H](C[C@]3(O)C[C@H]2OC3=O)O1 |
| InChI | InChI=1S/C8H8O6/c9-6-8(11)1-3(12-6)5-4(2-8)13-7(10)14-5/h3-5,11H,1-2H2/t3-,4-,5+,8-/m1/s1 |
| InChIKey | UBGYKJKQSPRMAM-XWJKOJJASA-N |
| XLogP | -0.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |