C13H16O2 — CID 11264176
(3aS,4R,6aR)-4-benzyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (PubChem CID 11264176) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-benzyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
| Compound Name | (3aS,4R,6aR)-4-benzyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 11264176 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3aS,4R,6aR)-4-benzyl-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
| SMILES | c1ccc(C[C@H]2CO[C@H]3OCC[C@@H]23)cc1 |
| InChI | InChI=1S/C13H16O2/c1-2-4-10(5-3-1)8-11-9-15-13-12(11)6-7-14-13/h1-5,11-13H,6-9H2/t11-,12-,13+/m0/s1 |
| InChIKey | GXRACHRSMHTAPZ-RWMBFGLXSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |