About 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol
6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol (PubChem CID 112642015) has the molecular formula C14H15NO2S
and a molecular weight of 261.35 g/mol. Its IUPAC name is 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol |
| PubChem CID | 112642015 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc2c(c1)C(O)(Cc1cncs1)CC2 |
| InChI | InChI=1S/C14H15NO2S/c1-17-11-3-2-10-4-5-14(16,13(10)6-11)7-12-8-15-9-18-12/h2-3,6,8-9,16H,4-5,7H2,1H3 |
| InChIKey | LAUGTIFQWYBROU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol?
The IUPAC name of 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol (CID 112642015) is 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol.
What is the SMILES notation for 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol?
The canonical SMILES for 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol is COc1ccc2c(c1)C(O)(Cc1cncs1)CC2.
What is the InChIKey of 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol?
The InChIKey is LAUGTIFQWYBROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S/c1-17-11-3-2-10-4-5-14(16,13(10)6-11)7-12-8-15-9-18-12/h2-3,6,8-9,16H,4-5,7H2,1H3.
What are the key properties of 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol?
6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol has a molecular weight of 261.35 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol is sourced from PubChem (CID 112642015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).