C14H15NO2S — CID 112642015
6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol (PubChem CID 112642015) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol.
| Compound Name | 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 112642015 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-methoxy-1-(1,3-thiazol-5-ylmethyl)-2,3-dihydroinden-1-ol |
| SMILES | COc1ccc2c(c1)C(O)(Cc1cncs1)CC2 |
| InChI | InChI=1S/C14H15NO2S/c1-17-11-3-2-10-4-5-14(16,13(10)6-11)7-12-8-15-9-18-12/h2-3,6,8-9,16H,4-5,7H2,1H3 |
| InChIKey | LAUGTIFQWYBROU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |