About 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one
1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one (PubChem CID 112642475) has the molecular formula C6H5F2NOS
and a molecular weight of 177.18 g/mol. Its IUPAC name is 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one.
Molecular Properties
| Compound Name | 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one |
| PubChem CID | 112642475 |
| Molecular Formula | C6H5F2NOS |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one |
| SMILES | O=C(Cc1cncs1)C(F)F |
| InChI | InChI=1S/C6H5F2NOS/c7-6(8)5(10)1-4-2-9-3-11-4/h2-3,6H,1H2 |
| InChIKey | ZOJWFZVLJSVSCM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one?
The IUPAC name of 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one (CID 112642475) is 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one.
What is the SMILES notation for 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one?
The canonical SMILES for 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one is O=C(Cc1cncs1)C(F)F.
What is the InChIKey of 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one?
The InChIKey is ZOJWFZVLJSVSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2NOS/c7-6(8)5(10)1-4-2-9-3-11-4/h2-3,6H,1H2.
What are the key properties of 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one?
1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one has a molecular weight of 177.18 g/mol, XLogP of 1.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-3-(1,3-thiazol-5-yl)propan-2-one is sourced from PubChem (CID 112642475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).