C14H19N3S — CID 112642797
N-propyl-1-pyridin-2-yl-3-(1,3-thiazol-5-yl)propan-2-amine (PubChem CID 112642797) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-propyl-1-pyridin-2-yl-3-(1,3-thiazol-5-yl)propan-2-amine.
| Compound Name | N-propyl-1-pyridin-2-yl-3-(1,3-thiazol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 112642797 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-propyl-1-pyridin-2-yl-3-(1,3-thiazol-5-yl)propan-2-amine |
| SMILES | CCCNC(Cc1ccccn1)Cc1cncs1 |
| InChI | InChI=1S/C14H19N3S/c1-2-6-16-13(9-14-10-15-11-18-14)8-12-5-3-4-7-17-12/h3-5,7,10-11,13,16H,2,6,8-9H2,1H3 |
| InChIKey | WDCINQJLCORNGK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |