C4HF7O2 — CID 11264349
4,4,5,5-tetrafluoro-2-(trifluoromethyl)-1,3-dioxolane (PubChem CID 11264349) has the molecular formula C4HF7O2 and a molecular weight of 214.04 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-2-(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 4,4,5,5-tetrafluoro-2-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 11264349 |
| Molecular Formula | C4HF7O2 |
| Molecular Weight | 214.04 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 4,4,5,5-tetrafluoro-2-(trifluoromethyl)-1,3-dioxolane |
| SMILES | FC(F)(F)C1OC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C4HF7O2/c5-2(6,7)1-12-3(8,9)4(10,11)13-1/h1H |
| InChIKey | KUGVCGSOVLLILW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.04 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|