About 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene
8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 11264398) has the molecular formula C14H16O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 11264398 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | C1=C(c2ccccc2)CCC2(C1)OCCO2 |
| InChI | InChI=1S/C14H16O2/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)15-10-11-16-14/h1-6H,7-11H2 |
| InChIKey | XACJCGDBQLDVLR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene (CID 11264398) is 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene is C1=C(c2ccccc2)CCC2(C1)OCCO2.
What is the InChIKey of 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene?
The InChIKey is XACJCGDBQLDVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2/c1-2-4-12(5-3-1)13-6-8-14(9-7-13)15-10-11-16-14/h1-6H,7-11H2.
What are the key properties of 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene?
8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene has a molecular weight of 216.28 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-phenyl-1,4-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 11264398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).