C14H18O2 — CID 11264438
(5aS,9aS)-3,3-dimethyl-2,4,5a,6,7,9a-hexahydrodibenzofuran-1-one (PubChem CID 11264438) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (5aS,9aS)-3,3-dimethyl-2,4,5a,6,7,9a-hexahydrodibenzofuran-1-one.
| Compound Name | (5aS,9aS)-3,3-dimethyl-2,4,5a,6,7,9a-hexahydrodibenzofuran-1-one |
|---|---|
| PubChem CID | 11264438 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (5aS,9aS)-3,3-dimethyl-2,4,5a,6,7,9a-hexahydrodibenzofuran-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@H]1CCC=C[C@@H]21 |
| InChI | InChI=1S/C14H18O2/c1-14(2)7-10(15)13-9-5-3-4-6-11(9)16-12(13)8-14/h3,5,9,11H,4,6-8H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | RTAGJMRMIFUONV-KOLCDFICSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|