About N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine
N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine (PubChem CID 112644510) has the molecular formula C10H16N6S2
and a molecular weight of 284.41 g/mol. Its IUPAC name is N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine |
| PubChem CID | 112644510 |
| Molecular Formula | C10H16N6S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine |
| SMILES | CC(C)NCCn1nnnc1SCc1cncs1 |
| InChI | InChI=1S/C10H16N6S2/c1-8(2)12-3-4-16-10(13-14-15-16)17-6-9-5-11-7-18-9/h5,7-8,12H,3-4,6H2,1-2H3 |
| InChIKey | ROFJTQYSHLIXNP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine?
The IUPAC name of N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine (CID 112644510) is N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine.
What is the SMILES notation for N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine?
The canonical SMILES for N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine is CC(C)NCCn1nnnc1SCc1cncs1.
What is the InChIKey of N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine?
The InChIKey is ROFJTQYSHLIXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N6S2/c1-8(2)12-3-4-16-10(13-14-15-16)17-6-9-5-11-7-18-9/h5,7-8,12H,3-4,6H2,1-2H3.
What are the key properties of N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine?
N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine has a molecular weight of 284.41 g/mol, XLogP of 1.42, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[5-(1,3-thiazol-5-ylmethylsulfanyl)tetrazol-1-yl]ethyl]propan-2-amine is sourced from PubChem (CID 112644510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).