About N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine
N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine (PubChem CID 112644558) has the molecular formula C11H16N4S
and a molecular weight of 236.34 g/mol. Its IUPAC name is N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine |
| PubChem CID | 112644558 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(Cc2cncs2)nc1C |
| InChI | InChI=1S/C11H16N4S/c1-3-12-4-10-6-15(14-9(10)2)7-11-5-13-8-16-11/h5-6,8,12H,3-4,7H2,1-2H3 |
| InChIKey | OECIMTVKMQRKPJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine?
The IUPAC name of N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine (CID 112644558) is N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine.
What is the SMILES notation for N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine?
The canonical SMILES for N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine is CCNCc1cn(Cc2cncs2)nc1C.
What is the InChIKey of N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine?
The InChIKey is OECIMTVKMQRKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4S/c1-3-12-4-10-6-15(14-9(10)2)7-11-5-13-8-16-11/h5-6,8,12H,3-4,7H2,1-2H3.
What are the key properties of N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine?
N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine has a molecular weight of 236.34 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-methyl-1-(1,3-thiazol-5-ylmethyl)pyrazol-4-yl]methyl]ethanamine is sourced from PubChem (CID 112644558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).