C15H27N3S — CID 112644850
5-[(2,2-diethyl-5-propylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 112644850) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is 5-[(2,2-diethyl-5-propylpiperazin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(2,2-diethyl-5-propylpiperazin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112644850 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 5-[(2,2-diethyl-5-propylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | CCCC1CN(Cc2cncs2)C(CC)(CC)CN1 |
| InChI | InChI=1S/C15H27N3S/c1-4-7-13-9-18(10-14-8-16-12-19-14)15(5-2,6-3)11-17-13/h8,12-13,17H,4-7,9-11H2,1-3H3 |
| InChIKey | JDNJIORSRXHQKM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |