C7H6N4OS — CID 112645380
1-(1,3-thiazol-5-ylmethyl)triazole-4-carbaldehyde (PubChem CID 112645380) has the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. Its IUPAC name is 1-(1,3-thiazol-5-ylmethyl)triazole-4-carbaldehyde.
| Compound Name | 1-(1,3-thiazol-5-ylmethyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 112645380 |
| Molecular Formula | C7H6N4OS |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 1-(1,3-thiazol-5-ylmethyl)triazole-4-carbaldehyde |
| SMILES | O=Cc1cn(Cc2cncs2)nn1 |
| InChI | InChI=1S/C7H6N4OS/c12-4-6-2-11(10-9-6)3-7-1-8-5-13-7/h1-2,4-5H,3H2 |
| InChIKey | HVLOQUCTZLKKPA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|