About (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride
(3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride (PubChem CID 11264609) has the molecular formula C9H20ClNOS
and a molecular weight of 225.78 g/mol. Its IUPAC name is (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride |
| PubChem CID | 11264609 |
| Molecular Formula | C9H20ClNOS |
| Molecular Weight | 225.78 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride |
| SMILES | CCCCSC[C@H]1CNC[C@@H]1O.Cl |
| InChI | InChI=1S/C9H19NOS.ClH/c1-2-3-4-12-7-8-5-10-6-9(8)11;/h8-11H,2-7H2,1H3;1H/t8-,9+;/m1./s1 |
| InChIKey | LCWZTTZLOQQLMO-RJUBDTSPSA-N |
| XLogP | 1.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.78 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride?
The IUPAC name of (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride (CID 11264609) is (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride?
The canonical SMILES for (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride is CCCCSC[C@H]1CNC[C@@H]1O.Cl.
What is the InChIKey of (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride?
The InChIKey is LCWZTTZLOQQLMO-RJUBDTSPSA-N. The full InChI is InChI=1S/C9H19NOS.ClH/c1-2-3-4-12-7-8-5-10-6-9(8)11;/h8-11H,2-7H2,1H3;1H/t8-,9+;/m1./s1.
What are the key properties of (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride?
(3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride has a molecular weight of 225.78 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(butylsulfanylmethyl)pyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 11264609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).