C13H19FN2O — CID 112646194
3-fluoro-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]aniline (PubChem CID 112646194) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-fluoro-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]aniline.
| Compound Name | 3-fluoro-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 112646194 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 3-fluoro-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]aniline |
| SMILES | COCC1CCN(Cc2cc(N)cc(F)c2)C1 |
| InChI | InChI=1S/C13H19FN2O/c1-17-9-10-2-3-16(7-10)8-11-4-12(14)6-13(15)5-11/h4-6,10H,2-3,7-9,15H2,1H3 |
| InChIKey | JHPOYSKIMHWXBN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|