C13H14FN3O — CID 112646342
3-[(3-amino-5-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 112646342) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is 3-[(3-amino-5-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[(3-amino-5-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 112646342 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-[(3-amino-5-fluorophenyl)methyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(Cc2cc(N)cc(F)c2)c(C)n1 |
| InChI | InChI=1S/C13H14FN3O/c1-8-3-13(18)17(9(2)16-8)7-10-4-11(14)6-12(15)5-10/h3-6H,7,15H2,1-2H3 |
| InChIKey | LDVJFFKIGFCNFW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|