C12H21NO3 — CID 11264648
N-[(1S)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide (PubChem CID 11264648) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[(1S)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide.
| Compound Name | N-[(1S)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide |
|---|---|
| PubChem CID | 11264648 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[(1S)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide |
| SMILES | C=CC[C@H](NC(C)=O)[C@@H]1OC(C)(C)O[C@H]1C |
| InChI | InChI=1S/C12H21NO3/c1-6-7-10(13-9(3)14)11-8(2)15-12(4,5)16-11/h6,8,10-11H,1,7H2,2-5H3,(H,13,14)/t8-,10-,11+/m0/s1 |
| InChIKey | XJFJNYQKMDFJLD-INTQDDNPSA-N |
| XLogP | 1.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|