C10H13FN2O3 — CID 112646660
2-[(3-fluoro-5-nitrophenyl)methylamino]propan-1-ol (PubChem CID 112646660) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-[(3-fluoro-5-nitrophenyl)methylamino]propan-1-ol.
| Compound Name | 2-[(3-fluoro-5-nitrophenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 112646660 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-[(3-fluoro-5-nitrophenyl)methylamino]propan-1-ol |
| SMILES | CC(CO)NCc1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13FN2O3/c1-7(6-14)12-5-8-2-9(11)4-10(3-8)13(15)16/h2-4,7,12,14H,5-6H2,1H3 |
| InChIKey | MIURCZMQRGNJJL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|