About (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide
(E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide (PubChem CID 11264794) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide |
| PubChem CID | 11264794 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide |
| SMILES | C/C=C/C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-4-8-13(16)15(3)11(2)14(17)12-9-6-5-7-10-12/h4-11,14,17H,1-3H3/b8-4+/t11-,14+/m0/s1 |
| InChIKey | CCCWVBDIDOTWGV-RSHKERQCSA-N |
| XLogP | 2.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide?
The IUPAC name of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide (CID 11264794) is (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide.
What is the SMILES notation for (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide?
The canonical SMILES for (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide is C/C=C/C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1.
What is the InChIKey of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide?
The InChIKey is CCCWVBDIDOTWGV-RSHKERQCSA-N. The full InChI is InChI=1S/C14H19NO2/c1-4-8-13(16)15(3)11(2)14(17)12-9-6-5-7-10-12/h4-11,14,17H,1-3H3/b8-4+/t11-,14+/m0/s1.
What are the key properties of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide?
(E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide has a molecular weight of 233.31 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methylbut-2-enamide is sourced from PubChem (CID 11264794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).