About 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline
3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline (PubChem CID 112648834) has the molecular formula C10H11N3S2
and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline.
Molecular Properties
| Compound Name | 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline |
| PubChem CID | 112648834 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline |
| SMILES | Cc1cc(N)cc(Sc2nc(C)ns2)c1 |
| InChI | InChI=1S/C10H11N3S2/c1-6-3-8(11)5-9(4-6)14-10-12-7(2)13-15-10/h3-5H,11H2,1-2H3 |
| InChIKey | XEZAASUMJQXMNP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline?
The IUPAC name of 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline (CID 112648834) is 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline.
What is the SMILES notation for 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline?
The canonical SMILES for 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline is Cc1cc(N)cc(Sc2nc(C)ns2)c1.
What is the InChIKey of 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline?
The InChIKey is XEZAASUMJQXMNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3S2/c1-6-3-8(11)5-9(4-6)14-10-12-7(2)13-15-10/h3-5H,11H2,1-2H3.
What are the key properties of 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline?
3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline has a molecular weight of 237.35 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]aniline is sourced from PubChem (CID 112648834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).