C14H20N2O2 — CID 112649328
3-methyl-5-nitro-N-(2,2,3,3-tetramethylcyclopropyl)aniline (PubChem CID 112649328) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-methyl-5-nitro-N-(2,2,3,3-tetramethylcyclopropyl)aniline.
| Compound Name | 3-methyl-5-nitro-N-(2,2,3,3-tetramethylcyclopropyl)aniline |
|---|---|
| PubChem CID | 112649328 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3-methyl-5-nitro-N-(2,2,3,3-tetramethylcyclopropyl)aniline |
| SMILES | Cc1cc(NC2C(C)(C)C2(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H20N2O2/c1-9-6-10(8-11(7-9)16(17)18)15-12-13(2,3)14(12,4)5/h6-8,12,15H,1-5H3 |
| InChIKey | PNQDQKZWOCHLOU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|