About 2-methylpentan-3-one
2-methylpentan-3-one (PubChem CID 11265) has the molecular formula C6H12O
and a molecular weight of 100.16 g/mol. Its IUPAC name is 2-methylpentan-3-one.
Molecular Properties
| Compound Name | 2-methylpentan-3-one |
| PubChem CID | 11265 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | 2-methylpentan-3-one |
| SMILES | CCC(=O)C(C)C |
| InChI | InChI=1S/C6H12O/c1-4-6(7)5(2)3/h5H,4H2,1-3H3 |
| InChIKey | HYTRYEXINDDXJK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentan-3-one?
The IUPAC name of 2-methylpentan-3-one (CID 11265) is 2-methylpentan-3-one.
What is the SMILES notation for 2-methylpentan-3-one?
The canonical SMILES for 2-methylpentan-3-one is CCC(=O)C(C)C.
What is the InChIKey of 2-methylpentan-3-one?
The InChIKey is HYTRYEXINDDXJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O/c1-4-6(7)5(2)3/h5H,4H2,1-3H3.
What are the key properties of 2-methylpentan-3-one?
2-methylpentan-3-one has a molecular weight of 100.16 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-3-one is sourced from PubChem (CID 11265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).