C14H14ClFN2 — CID 112651837
N-[(2-chloro-3-fluorophenyl)methyl]-1-pyridin-3-ylethanamine (PubChem CID 112651837) has the molecular formula C14H14ClFN2 and a molecular weight of 264.73 g/mol. Its IUPAC name is N-[(2-chloro-3-fluorophenyl)methyl]-1-pyridin-3-ylethanamine.
| Compound Name | N-[(2-chloro-3-fluorophenyl)methyl]-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 112651837 |
| Molecular Formula | C14H14ClFN2 |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-[(2-chloro-3-fluorophenyl)methyl]-1-pyridin-3-ylethanamine |
| SMILES | CC(NCc1cccc(F)c1Cl)c1cccnc1 |
| InChI | InChI=1S/C14H14ClFN2/c1-10(11-5-3-7-17-8-11)18-9-12-4-2-6-13(16)14(12)15/h2-8,10,18H,9H2,1H3 |
| InChIKey | OQGJGLNOHUFMDQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |