C9H12ClFN2 — CID 112652223
2-[(2-chloro-3-fluorophenyl)methyl]-1,1-dimethylhydrazine (PubChem CID 112652223) has the molecular formula C9H12ClFN2 and a molecular weight of 202.66 g/mol. Its IUPAC name is 2-[(2-chloro-3-fluorophenyl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(2-chloro-3-fluorophenyl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 112652223 |
| Molecular Formula | C9H12ClFN2 |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-[(2-chloro-3-fluorophenyl)methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCc1cccc(F)c1Cl |
| InChI | InChI=1S/C9H12ClFN2/c1-13(2)12-6-7-4-3-5-8(11)9(7)10/h3-5,12H,6H2,1-2H3 |
| InChIKey | JTHRGSAQHORXNS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|