C13H12N6 — CID 11265235
(7-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene (PubChem CID 11265235) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is (7-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene.
| Compound Name | (7-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene |
|---|---|
| PubChem CID | 11265235 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (7-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-phenyldiazene |
| SMILES | CCc1c(/N=N/c2ccccc2)cnc2ncnn12 |
| InChI | InChI=1S/C13H12N6/c1-2-12-11(8-14-13-15-9-16-19(12)13)18-17-10-6-4-3-5-7-10/h3-9H,2H2,1H3/b18-17+ |
| InChIKey | REDSQDKSHCVVPS-ISLYRVAYSA-N |
| XLogP | 3.10 |
| TPSA | 67.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|