About 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one
2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one (PubChem CID 11265236) has the molecular formula C12H12O4S
and a molecular weight of 252.29 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one |
| PubChem CID | 11265236 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(CC(=O)c2cccs2)O1 |
| InChI | InChI=1S/C12H12O4S/c1-12(2)15-8(7-11(14)16-12)6-9(13)10-4-3-5-17-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | YREGCSRPGFICEG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one?
The IUPAC name of 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one (CID 11265236) is 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one.
What is the SMILES notation for 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one?
The canonical SMILES for 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one is CC1(C)OC(=O)C=C(CC(=O)c2cccs2)O1.
What is the InChIKey of 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one?
The InChIKey is YREGCSRPGFICEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O4S/c1-12(2)15-8(7-11(14)16-12)6-9(13)10-4-3-5-17-10/h3-5,7H,6H2,1-2H3.
What are the key properties of 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one?
2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one has a molecular weight of 252.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(2-oxo-2-thiophen-2-ylethyl)-1,3-dioxin-4-one is sourced from PubChem (CID 11265236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).