C12H15ClFN3O — CID 112652370
1-[(2-chloro-3-fluorophenyl)methyl]-N'-hydroxypyrrolidine-2-carboximidamide (PubChem CID 112652370) has the molecular formula C12H15ClFN3O and a molecular weight of 271.72 g/mol. Its IUPAC name is 1-[(2-chloro-3-fluorophenyl)methyl]-N'-hydroxypyrrolidine-2-carboximidamide.
| Compound Name | 1-[(2-chloro-3-fluorophenyl)methyl]-N'-hydroxypyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 112652370 |
| Molecular Formula | C12H15ClFN3O |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-[(2-chloro-3-fluorophenyl)methyl]-N'-hydroxypyrrolidine-2-carboximidamide |
| SMILES | N/C(=N/O)C1CCCN1Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H15ClFN3O/c13-11-8(3-1-4-9(11)14)7-17-6-2-5-10(17)12(15)16-18/h1,3-4,10,18H,2,5-7H2,(H2,15,16) |
| InChIKey | AAAUNAJERNKFMP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|