C12H15ClFN — CID 112652653
2-[(2-chloro-3-fluorophenyl)methyl]cyclopentan-1-amine (PubChem CID 112652653) has the molecular formula C12H15ClFN and a molecular weight of 227.71 g/mol. Its IUPAC name is 2-[(2-chloro-3-fluorophenyl)methyl]cyclopentan-1-amine.
| Compound Name | 2-[(2-chloro-3-fluorophenyl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 112652653 |
| Molecular Formula | C12H15ClFN |
| Molecular Weight | 227.71 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[(2-chloro-3-fluorophenyl)methyl]cyclopentan-1-amine |
| SMILES | NC1CCCC1Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H15ClFN/c13-12-9(4-1-5-10(12)14)7-8-3-2-6-11(8)15/h1,4-5,8,11H,2-3,6-7,15H2 |
| InChIKey | NASKIWWNPFPRPN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |