C14H28S2 — CID 11265450
2-[(2S,4S)-2,4-dimethyloctyl]-1,3-dithiane (PubChem CID 11265450) has the molecular formula C14H28S2 and a molecular weight of 260.51 g/mol. Its IUPAC name is 2-[(2S,4S)-2,4-dimethyloctyl]-1,3-dithiane.
| Compound Name | 2-[(2S,4S)-2,4-dimethyloctyl]-1,3-dithiane |
|---|---|
| PubChem CID | 11265450 |
| Molecular Formula | C14H28S2 |
| Molecular Weight | 260.51 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[(2S,4S)-2,4-dimethyloctyl]-1,3-dithiane |
| SMILES | CCCC[C@H](C)C[C@H](C)CC1SCCCS1 |
| InChI | InChI=1S/C14H28S2/c1-4-5-7-12(2)10-13(3)11-14-15-8-6-9-16-14/h12-14H,4-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | FFBXMAVQAUCINL-STQMWFEESA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |